ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
506-24-1 stearolic acid |
|
| Chemical Name | stearolic acid |
| Synonyms | Octadec-9-ynoic acid |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.4455 |
| InChl | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) |
| CAS Registry Number | 506-24-1 |
| EINECS | 208-030-8 |
| Molecular Structure | ![]() |
| Density | 0.923g/cm3 |
| Boiling Point | 405.2°C at 760 mmHg |
| Refractive Index | 1.471 |
| Flash Point | 196.3°C |
| Vapour Pressur | 1.07E-07mmHg at 25°C |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |