ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
506-24-1 stearolic acid | 
    |
| Nome del prodotto | stearolic acid | 
| Nome inglese | stearolic acid;Octadec-9-ynoic acid | 
| Formula molecolare | C18H32O2 | 
| Peso Molecolare | 280.4455 | 
| InChI | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) | 
| Numero CAS | 506-24-1 | 
| EINECS | 208-030-8 | 
| Struttura molecolare | ![]()  | 
    
| Densità | 0.923g/cm3 | 
| Punto di ebollizione | 405.2°C at 760 mmHg | 
| Indice di rifrazione | 1.471 | 
| Punto d'infiammabilità | 196.3°C | 
| Pressione di vapore | 1.07E-07mmHg at 25°C | 
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
    
| MSDS | |