ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
506-24-1 stearolic acid |
|
| Nom | stearolic acid |
| Nom anglais | stearolic acid;Octadec-9-ynoic acid |
| Formule moléculaire | C18H32O2 |
| Poids Moléculaire | 280.4455 |
| InChl | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) |
| Numéro de registre CAS | 506-24-1 |
| EINECS | 208-030-8 |
| Structure moléculaire | ![]() |
| Densité | 0.923g/cm3 |
| Point d'ébullition | 405.2°C at 760 mmHg |
| Indice de réfraction | 1.471 |
| Point d'éclair | 196.3°C |
| Pression de vapeur | 1.07E-07mmHg at 25°C |
| Description de sécurité | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |