ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 56652-31-4 5-oxo-L-proline, compound with (8α,9R)-6'-methoxycinchonan-9-ol (1:1) | |
| Chemical Name | 5-oxo-L-proline, compound with (8α,9R)-6'-methoxycinchonan-9-ol (1:1) | 
| Synonyms | 5-Oxo-L-proline, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (1:1);5-oxo-L-proline - 6'-methoxycinchonan-9-ol (1:1) | 
| Molecular Formula | C25H31N3O5 | 
| Molecular Weight | 453.5307 | 
| InChl | InChI=1/C20H24N2O2.C5H7NO3/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;7-4-2-1-3(6-4)5(8)9/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 | 
| CAS Registry Number | 56652-31-4 | 
| EINECS | 260-311-4 | 
| Molecular Structure |  | 
| Boiling Point | 495.9°C at 760 mmHg | 
| Flash Point | 253.7°C | 
| Vapour Pressur | 1.19E-10mmHg at 25°C | 
| MSDS | |