ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56652-31-4 5-okso-L-prolin, (8α, 9R) -6'-metoksisinkon-9-ol (1: 1) ile bileşik |
|
| Ürün Adı | 5-okso-L-prolin, (8α, 9R) -6'-metoksisinkon-9-ol (1: 1) ile bileşik |
| Eş anlamlı | 5-Okso-L-prolin, (8alfa,9R)-6'-metoksisinkon-9-ol (1:1) ile bileşik; 5-okso-L-prolin - 6'-metoksisinkon-9-ol (1: 1); |
| ingilizce adı | 5-oxo-L-proline, compound with (8α,9R)-6'-methoxycinchonan-9-ol (1:1);5-Oxo-L-proline, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (1:1);5-oxo-L-proline - 6'-methoxycinchonan-9-ol (1:1) |
| Moleküler Formülü | C25H31N3O5 |
| Molekül Ağırlığı | 453.5307 |
| InChI | InChI=1/C20H24N2O2.C5H7NO3/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;7-4-2-1-3(6-4)5(8)9/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
| CAS kayıt numarası | 56652-31-4 |
| EINECS | 260-311-4 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 495.9°C at 760 mmHg |
| Alevlenme noktası | 253.7°C |
| Buhar basıncı | 1.19E-10mmHg at 25°C |
| MSDS | |