ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56652-31-4 5-옥소-L-프롤린, (8α,9R)-6'-메톡시신초난-9-올(1:1)과 화합물 |
|
| 상품명칭 | 5-옥소-L-프롤린, (8α,9R)-6'-메톡시신초난-9-올(1:1)과 화합물 |
| 별명 | 5-Oxo-L-프롤린, (8alpha,9R)-6'-methoxycinchonan-9-ol(1:1)과 화합물; 5-옥소-L-프롤린-6'-메톡시신초난-9-올(1:1); |
| 영문 이름 | 5-oxo-L-proline, compound with (8α,9R)-6'-methoxycinchonan-9-ol (1:1);5-Oxo-L-proline, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (1:1);5-oxo-L-proline - 6'-methoxycinchonan-9-ol (1:1) |
| 분자식 | C25H31N3O5 |
| 분자량 | 453.5307 |
| InChI | InChI=1/C20H24N2O2.C5H7NO3/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;7-4-2-1-3(6-4)5(8)9/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
| cas번호 | 56652-31-4 |
| EC번호 | 260-311-4 |
| 분자 구조 | ![]() |
| 비등점 | 495.9°C at 760 mmHg |
| 인화점 | 253.7°C |
| 증기압 | 1.19E-10mmHg at 25°C |
| MSDS | |