ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-79-0 3,3'-Diaminobenzophenone |
|
| Chemical Name | 3,3'-Diaminobenzophenone |
| Synonyms | bis(3-aminophenyl)methanone |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.2472 |
| InChl | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
| CAS Registry Number | 611-79-0 |
| EINECS | 210-281-3 |
| Molecular Structure | ![]() |
| Density | 1.233g/cm3 |
| Boiling Point | 469.4°C at 760 mmHg |
| Refractive Index | 1.673 |
| Flash Point | 237.7°C |
| Vapour Pressur | 5.51E-09mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |