ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-79-0 3,3'-Diaminobenzophenone |
|
| Nome do produto | 3,3'-Diaminobenzophenone |
| Nome em inglês | 3,3'-Diaminobenzophenone;bis(3-aminophenyl)methanone |
| Fórmula molecular | C13H12N2O |
| Peso Molecular | 212.2472 |
| InChI | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
| CAS Registry Number | 611-79-0 |
| EINECS | 210-281-3 |
| Estrutura Molecular | ![]() |
| Densidade | 1.233g/cm3 |
| Ponto de ebulição | 469.4°C at 760 mmHg |
| índice de refração | 1.673 |
| O ponto de inflamação | 237.7°C |
| Pressão de vapor | 5.51E-09mmHg at 25°C |
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |