ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-79-0 3,3'-Diaminobenzophenone |
|
| उत्पाद का नाम | 3,3'-Diaminobenzophenone |
| अंग्रेज | 3,3'-Diaminobenzophenone;bis(3-aminophenyl)methanone |
| आणविक फार्मूला | C13H12N2O |
| आण्विक वजन | 212.2472 |
| InChI | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
| कैस रजिस्टी संख्या | 611-79-0 |
| EINECS | 210-281-3 |
| आणविक संरचना | ![]() |
| घनत्व | 1.233g/cm3 |
| उबलने का समय | 469.4°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.673 |
| फ्लैश प्वाइंट | 237.7°C |
| वाष्प का दबाव | 5.51E-09mmHg at 25°C |
| खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |