83-27-2 Diethyl sec-Butylmalonate |
| Product Name |
Diethyl sec-Butylmalonate |
| Synonyms |
Butylmalonicaciddiethylester;sec-Butylmalonic acid diethyl ester;diethyl butan-2-ylpropanedioate;diethyl [(1S)-1-methylpropyl]propanedioate;diethyl [(1R)-1-methylpropyl]propanedioate |
| Molecular Formula |
C11H20O4 |
| Molecular Weight |
216.2741 |
| InChl |
InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
| CAS Registry Number |
83-27-2 |
| EINECS |
201-463-3 |
| Molecular Structure |
 |
| Density |
0.992g/cm3 |
| Boiling Point |
247.5°C at 760 mmHg |
| Refractive Index |
1.431 |
| Flash Point |
103.1°C |
| Vapour Pressur |
0.0256mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
