ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-27-2 Diethyl sec-Butylmalonate |
|
| Naam product | Diethyl sec-Butylmalonate |
| Engelse naam | Diethyl sec-Butylmalonate;Butylmalonicaciddiethylester;sec-Butylmalonic acid diethyl ester;diethyl butan-2-ylpropanedioate;diethyl [(1S)-1-methylpropyl]propanedioate;diethyl [(1R)-1-methylpropyl]propanedioate |
| MF | C11H20O4 |
| Molecuulgewicht | 216.2741 |
| InChI | InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
| CAS-nummer | 83-27-2 |
| EINECS | 201-463-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.992g/cm3 |
| Kookpunt | 247.5°C at 760 mmHg |
| Brekingsindex | 1.431 |
| Vlampunt | 103.1°C |
| Dampdruk | 0.0256mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |