ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-27-2 Diethyl sec-Butylmalonate |
|
| 상품명칭 | Diethyl sec-Butylmalonate |
| 영문 이름 | Diethyl sec-Butylmalonate;Butylmalonicaciddiethylester;sec-Butylmalonic acid diethyl ester;diethyl butan-2-ylpropanedioate;diethyl [(1S)-1-methylpropyl]propanedioate;diethyl [(1R)-1-methylpropyl]propanedioate |
| 분자식 | C11H20O4 |
| 분자량 | 216.2741 |
| InChI | InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
| cas번호 | 83-27-2 |
| EC번호 | 201-463-3 |
| 분자 구조 | ![]() |
| 밀도 | 0.992g/cm3 |
| 비등점 | 247.5°C at 760 mmHg |
| 굴절 지수 | 1.431 |
| 인화점 | 103.1°C |
| 증기압 | 0.0256mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |