ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-05-1 2,4,6-Trimethylaniline |
|
| Chemical Name | 2,4,6-Trimethylaniline |
| Synonyms | 2,4,6-trimethylbenzenamine;2,4,6-Trimethylaniline (mesidine);Mesidine |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.2062 |
| InChl | InChI=1/C9H13N/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,10H2,1-3H3 |
| CAS Registry Number | 88-05-1 |
| EINECS | 201-794-3 |
| Molecular Structure | ![]() |
| Density | 0.962g/cm3 |
| Melting Point | -5℃ |
| Boiling Point | 231.3°C at 760 mmHg |
| Refractive Index | 1.552 |
| Flash Point | 96.1°C |
| Water Solubility | IMMISCIBLE |
| Vapour Pressur | 0.0627mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R23/24/25||R33:; |
| Safety Description | S28A||S36/37||S45:; |
| MSDS | |