ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-05-1 2,4,6-Trimethylaniline |
|
| Produkt-Name | 2,4,6-Trimethylaniline |
| Englischer Name | 2,4,6-Trimethylaniline;2,4,6-trimethylbenzenamine;2,4,6-Trimethylaniline (mesidine);Mesidine |
| Molekulare Formel | C9H13N |
| Molecular Weight | 135.2062 |
| InChl | InChI=1/C9H13N/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,10H2,1-3H3 |
| CAS Registry Number | 88-05-1 |
| EINECS | 201-794-3 |
| Molecular Structure | ![]() |
| Dichte | 0.962g/cm3 |
| Schmelzpunkt | -5℃ |
| Siedepunkt | 231.3°C at 760 mmHg |
| Brechungsindex | 1.552 |
| Flammpunkt | 96.1°C |
| Wasserlöslichkeit | IMMISCIBLE |
| Dampfdruck | 0.0627mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R23/24/25||R33:; |
| Safety Beschreibung | S28A||S36/37||S45:; |
| MSDS | |