ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-05-1 2,4,6-Trimethylaniline |
|
| Nazwa produktu: | 2,4,6-Trimethylaniline |
| Angielska nazwa | 2,4,6-Trimethylaniline;2,4,6-trimethylbenzenamine;2,4,6-Trimethylaniline (mesidine);Mesidine |
| MF | C9H13N |
| Masie cząsteczkowej | 135.2062 |
| InChI | InChI=1/C9H13N/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,10H2,1-3H3 |
| Nr CAS | 88-05-1 |
| EINECS | 201-794-3 |
| Struktury molekularnej | ![]() |
| Gęstość | 0.962g/cm3 |
| Temperatura topnienia | -5℃ |
| Temperatura wrzenia | 231.3°C at 760 mmHg |
| Współczynnik załamania | 1.552 |
| Temperatura zapłonu | 96.1°C |
| Rozpuszczalność w wodzie | IMMISCIBLE |
| Ciśnienie pary | 0.0627mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R23/24/25||R33:; |
| Bezpieczeństwo opis | S28A||S36/37||S45:; |
| MSDS | |