ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
501014-44-4 2-Indanylboronic acid diethanolamine cyclic ester |
|
název výrobku | 2-Indanylboronic acid diethanolamine cyclic ester |
Anglický název | 2-Indanylboronic acid diethanolamine cyclic ester;2-(2,3-dihydro-1H-inden-2-yl)-1,3,6,2-dioxazaborocane |
Molekulární vzorec | C13H18BNO2 |
Molekulová hmotnost | 231.0985 |
InChl | InChI=1/C13H18BNO2/c1-2-4-12-10-13(9-11(12)3-1)14-16-7-5-15-6-8-17-14/h1-4,13,15H,5-10H2 |
Registrační číslo CAS | 501014-44-4 |
Molekulární struktura | ![]() |
Hustota | 1.101g/cm3 |
Bod varu | 350.733°C at 760 mmHg |
Index lomu | 1.538 |
Bod vzplanutí | 165.917°C |
Tlak par | 0mmHg at 25°C |
Riziko Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |