ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
116525-66-7 3-(4-Chlorphenyl)-4-cyano-5-(methylthio)thiophen-2-carbonsäure |
|
Produkt-Name | 3-(4-Chlorphenyl)-4-cyano-5-(methylthio)thiophen-2-carbonsäure |
Synonyme | 3-(4-Chlorphenyl)-4-cyano-5-(methylsulfanyl)thiophen-2-carbonsäure; |
Englischer Name | 3-(4-chlorophenyl)-4-cyano-5-(methylthio)thiophene-2-carboxylic acid;3-(4-chlorophenyl)-4-cyano-5-(methylsulfanyl)thiophene-2-carboxylic acid |
Molekulare Formel | C13H8ClNO2S2 |
Molecular Weight | 309.7911 |
InChl | InChI=1/C13H8ClNO2S2/c1-18-13-9(6-15)10(11(19-13)12(16)17)7-2-4-8(14)5-3-7/h2-5H,1H3,(H,16,17) |
CAS Registry Number | 116525-66-7 |
Molecular Structure | ![]() |
Dichte | 1.53g/cm3 |
Schmelzpunkt | 241℃ |
Siedepunkt | 457.5°C at 760 mmHg |
Brechungsindex | 1.699 |
Flammpunkt | 230.5°C |
Dampfdruck | 3.67E-09mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |