ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
116525-66-7 3-(4-klorfenyl)-4-cyano-5-(metyltio)tiofen-2-karboksylsyre |
|
produktnavn | 3-(4-klorfenyl)-4-cyano-5-(metyltio)tiofen-2-karboksylsyre |
Synonymer | 3-(4-klorfenyl)-4-cyano-5-(metylsulfanyl)tiofen-2-karboksylsyre; |
Engelsk navn | 3-(4-chlorophenyl)-4-cyano-5-(methylthio)thiophene-2-carboxylic acid;3-(4-chlorophenyl)-4-cyano-5-(methylsulfanyl)thiophene-2-carboxylic acid |
Molekylær Formel | C13H8ClNO2S2 |
Molekylvekt | 309.7911 |
InChI | InChI=1/C13H8ClNO2S2/c1-18-13-9(6-15)10(11(19-13)12(16)17)7-2-4-8(14)5-3-7/h2-5H,1H3,(H,16,17) |
CAS-nummer | 116525-66-7 |
Molecular Structure | ![]() |
Tetthet | 1.53g/cm3 |
Smeltepunkt | 241℃ |
Kokepunkt | 457.5°C at 760 mmHg |
Brytningsindeks | 1.699 |
Flammepunktet | 230.5°C |
Damptrykk | 3.67E-09mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |