Chemindex >116525-66-7
MY ▼
116525-66-7 3-(4-chlorophenyl)-4-cyano-5-(methylthio)thiophene-2-asid karboksilik |
|
| Nama produk | 3-(4-chlorophenyl)-4-cyano-5-(methylthio)thiophene-2-asid karboksilik |
| Sinonim | 3-(4-chlorophenyl)-4-cyano-5-(methylsulfanyl)thiophene-2-asid karboksilik; |
| Nama Inggeris | 3-(4-chlorophenyl)-4-cyano-5-(methylthio)thiophene-2-carboxylic acid;3-(4-chlorophenyl)-4-cyano-5-(methylsulfanyl)thiophene-2-carboxylic acid |
| MF | C13H8ClNO2S2 |
| Berat Molekul | 309.7911 |
| InChI | InChI=1/C13H8ClNO2S2/c1-18-13-9(6-15)10(11(19-13)12(16)17)7-2-4-8(14)5-3-7/h2-5H,1H3,(H,16,17) |
| CAS NO | 116525-66-7 |
| Struktur Molekul |  |
| Kepadatan | 1.53g/cm3 |
| Titik lebur | 241℃ |
| Titik didih | 457.5°C at 760 mmHg |
| Indeks bias | 1.699 |
| Titik nyala | 230.5°C |
| Tekanan wap | 3.67E-09mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Penerangan | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 116525-66-7 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 