ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
135159-25-0 2,4,6-Trimethoxybenzeneboronic acid |
|
Produkt-Name | 2,4,6-Trimethoxybenzeneboronic acid |
Englischer Name | 2,4,6-Trimethoxybenzeneboronic acid;2,4,6-Trimethoxyphenylboronic acid |
Molekulare Formel | C9H13BO5 |
Molecular Weight | 212.0075 |
InChl | InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
CAS Registry Number | 135159-25-0 |
Molecular Structure | ![]() |
Dichte | 1.21g/cm3 |
Siedepunkt | 413.8°C at 760 mmHg |
Brechungsindex | 1.513 |
Flammpunkt | 204.1°C |
Dampfdruck | 1.37E-07mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |