ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
135159-25-0 2,4,6-Trimethoxybenzeneboronic acid |
|
उत्पाद का नाम | 2,4,6-Trimethoxybenzeneboronic acid |
अंग्रेज | 2,4,6-Trimethoxybenzeneboronic acid;2,4,6-Trimethoxyphenylboronic acid |
आणविक फार्मूला | C9H13BO5 |
आण्विक वजन | 212.0075 |
InChI | InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
कैस रजिस्टी संख्या | 135159-25-0 |
आणविक संरचना | ![]() |
घनत्व | 1.21g/cm3 |
उबलने का समय | 413.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.513 |
फ्लैश प्वाइंट | 204.1°C |
वाष्प का दबाव | 1.37E-07mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |