ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
135159-25-0 2,4,6-Trimethoxybenzeneboronic acid |
|
Nama produk | 2,4,6-Trimethoxybenzeneboronic acid |
Nama bahasa Inggris | 2,4,6-Trimethoxybenzeneboronic acid;2,4,6-Trimethoxyphenylboronic acid |
MF | C9H13BO5 |
Berat Molekul | 212.0075 |
InChI | InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
CAS NO | 135159-25-0 |
Struktur Molekul | ![]() |
Kepadatan | 1.21g/cm3 |
Titik didih | 413.8°C at 760 mmHg |
Indeks bias | 1.513 |
Titik nyala | 204.1°C |
Tekanan uap | 1.37E-07mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |