ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
209958-45-2 3-(2-Formyl-1H-pyrrol-1-yl)benzonitril |
|
| Produkt-Name | 3-(2-Formyl-1H-pyrrol-1-yl)benzonitril |
| Englischer Name | 3-(2-formyl-1H-pyrrol-1-yl)benzonitrile; |
| Molekulare Formel | C12H8N2O |
| Molecular Weight | 196.2047 |
| InChl | InChI=1/C12H8N2O/c13-8-10-3-1-4-11(7-10)14-6-2-5-12(14)9-15/h1-7,9H |
| CAS Registry Number | 209958-45-2 |
| Molecular Structure | ![]() |
| Dichte | 1.13g/cm3 |
| Schmelzpunkt | 145℃ |
| Siedepunkt | 377.4°C at 760 mmHg |
| Brechungsindex | 1.601 |
| Flammpunkt | 182.1°C |
| Dampfdruck | 6.76E-06mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |