ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
209958-45-2 3- (2- 포르밀 -1H- 피롤 -1- 일) 벤조니트릴 |
|
| 상품명칭 | 3- (2- 포르밀 -1H- 피롤 -1- 일) 벤조니트릴 |
| 영문 이름 | 3-(2-formyl-1H-pyrrol-1-yl)benzonitrile; |
| 분자식 | C12H8N2O |
| 분자량 | 196.2047 |
| InChI | InChI=1/C12H8N2O/c13-8-10-3-1-4-11(7-10)14-6-2-5-12(14)9-15/h1-7,9H |
| cas번호 | 209958-45-2 |
| 분자 구조 | ![]() |
| 밀도 | 1.13g/cm3 |
| 녹는 점 | 145℃ |
| 비등점 | 377.4°C at 760 mmHg |
| 굴절 지수 | 1.601 |
| 인화점 | 182.1°C |
| 증기압 | 6.76E-06mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |