ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
209958-45-2 3-(2-formyl-1H-pyrrol-1-yl)benzonitril |
|
| Naam product | 3-(2-formyl-1H-pyrrol-1-yl)benzonitril |
| Engelse naam | 3-(2-formyl-1H-pyrrol-1-yl)benzonitrile; |
| MF | C12H8N2O |
| Molecuulgewicht | 196.2047 |
| InChI | InChI=1/C12H8N2O/c13-8-10-3-1-4-11(7-10)14-6-2-5-12(14)9-15/h1-7,9H |
| CAS-nummer | 209958-45-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.13g/cm3 |
| Smeltpunt | 145℃ |
| Kookpunt | 377.4°C at 760 mmHg |
| Brekingsindex | 1.601 |
| Vlampunt | 182.1°C |
| Dampdruk | 6.76E-06mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Veiligheid Omschrijving | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |