Chemindex > 22232-01-5
DE ▼
22232-01-5 Bis(2-aminoethanol), Diester mit Borsäure |
|
| Produkt-Name | Bis(2-aminoethanol), Diester mit Borsäure |
| Synonyme | Ethanol, 2-Amino-, 1,1'-Diester mit Borsäure (H3BO3); Bis(2-aminoethyl)borat; Borsäure, Monoethanolamin-Diester; Caswell: Nein.088; Bis(2-aminoethanol), Diester mit Borsäure; Ethanol, 2-Amino-, Diester mit Borsäure (H3BO3); Bis(2-aminoethyl)hydrogenborat; |
| Englischer Name | bis(2-aminoethanol), diester with boric acid;Ethanol, 2-amino-, 1,1'-diester with boric acid (H3BO3);Bis(2-aminoethyl)borate;Boric acid, monoethanolamine diester;Caswell No. 088;Bis(2-aminoethanol), diester with boric acid;Ethanol, 2-amino-, diester with boric acid (H3BO3);bis(2-aminoethyl) hydrogen borate |
| Molekulare Formel | C4H13BN2O3 |
| Molecular Weight | 147.9686 |
| InChl | InChI=1/C4H13BN2O3/c6-1-3-9-5(8)10-4-2-7/h8H,1-4,6-7H2 |
| CAS Registry Number | 22232-01-5 |
| EINECS | 244-852-3 |
| Molecular Structure |  |
| Dichte | 1.103g/cm3 |
| Siedepunkt | 243.4°C at 760 mmHg |
| Brechungsindex | 1.45 |
| Flammpunkt | 101°C |
| Dampfdruck | 0.00544mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 22232-01-5 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 