ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22232-01-5 bisz(2-aminoetanol), diészter bórsavval |
|
termék neve | bisz(2-aminoetanol), diészter bórsavval |
Szinonimák | Etanol, 2-amino-, 1,1'-diészter bórsavval (H3BO3); Bisz(2-aminoetil)borát; Bórsav, monoetanol-amin diészter; Caswell: Nem.088; Bisz(2-aminoetanol), diészter bórsavval; Etanol, 2-amino-, diészter bórsavval (H3BO3); bisz(2-aminoetil)hidrogén-borát; |
Angol név | bis(2-aminoethanol), diester with boric acid;Ethanol, 2-amino-, 1,1'-diester with boric acid (H3BO3);Bis(2-aminoethyl)borate;Boric acid, monoethanolamine diester;Caswell No. 088;Bis(2-aminoethanol), diester with boric acid;Ethanol, 2-amino-, diester with boric acid (H3BO3);bis(2-aminoethyl) hydrogen borate |
MF | C4H13BN2O3 |
Molekulatömeg | 147.9686 |
InChI | InChI=1/C4H13BN2O3/c6-1-3-9-5(8)10-4-2-7/h8H,1-4,6-7H2 |
CAS-szám | 22232-01-5 |
EINECS | 244-852-3 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.103g/cm3 |
Forráspont | 243.4°C at 760 mmHg |
Törésmutató | 1.45 |
Gyulladáspont | 101°C |
Gőznyomás | 0.00544mmHg at 25°C |
MSDS |