ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22232-01-5 bis(2-aminoethanol), diester dengan asid borik |
|
Nama produk | bis(2-aminoethanol), diester dengan asid borik |
Sinonim | Etanol, 2-amino-, 1,1'-diester dengan asid borik (H3BO3); Bis(2-aminoethyl)borate; Asid borik, diester monoethanolamine; Caswell No.088; Bis(2-aminoethanol), diester dengan asid borik; Etanol, 2-amino-, diester dengan asid borik (H3BO3); Bis (2-aminoethyl) hidrogen borate; |
Nama Inggeris | bis(2-aminoethanol), diester with boric acid;Ethanol, 2-amino-, 1,1'-diester with boric acid (H3BO3);Bis(2-aminoethyl)borate;Boric acid, monoethanolamine diester;Caswell No. 088;Bis(2-aminoethanol), diester with boric acid;Ethanol, 2-amino-, diester with boric acid (H3BO3);bis(2-aminoethyl) hydrogen borate |
MF | C4H13BN2O3 |
Berat Molekul | 147.9686 |
InChI | InChI=1/C4H13BN2O3/c6-1-3-9-5(8)10-4-2-7/h8H,1-4,6-7H2 |
CAS NO | 22232-01-5 |
EINECS | 244-852-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.103g/cm3 |
Titik didih | 243.4°C at 760 mmHg |
Indeks bias | 1.45 |
Titik nyala | 101°C |
Tekanan wap | 0.00544mmHg at 25°C |
MSDS |