ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
227958-96-5 Ethyl-4,6-dichlor-2-(methylthio)chinolin-3-carboxylat |
|
Produkt-Name | Ethyl-4,6-dichlor-2-(methylthio)chinolin-3-carboxylat |
Synonyme | Ethyl-4,6-dichlor-2-(methylsulfanyl)chinolin-3-carboxylat; |
Englischer Name | ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate;ethyl 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate |
Molekulare Formel | C13H11Cl2NO2S |
Molecular Weight | 316.2029 |
InChl | InChI=1/C13H11Cl2NO2S/c1-3-18-13(17)10-11(15)8-6-7(14)4-5-9(8)16-12(10)19-2/h4-6H,3H2,1-2H3 |
CAS Registry Number | 227958-96-5 |
Molecular Structure | ![]() |
Dichte | 1.42g/cm3 |
Schmelzpunkt | 133℃ |
Siedepunkt | 410.2°C at 760 mmHg |
Brechungsindex | 1.643 |
Flammpunkt | 201.9°C |
Dampfdruck | 6.12E-07mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |