ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
227958-96-5 etyl 4,6-diklor-2-(metylthio)kinolin-3-karboksylat |
|
produktnavn | etyl 4,6-diklor-2-(metylthio)kinolin-3-karboksylat |
Synonymer | etyl 4,6-diklor-2-(metylsulfanyl)kinolin-3-karboksylat; |
Engelsk navn | ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate;ethyl 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate |
Molekylær Formel | C13H11Cl2NO2S |
Molekylvekt | 316.2029 |
InChI | InChI=1/C13H11Cl2NO2S/c1-3-18-13(17)10-11(15)8-6-7(14)4-5-9(8)16-12(10)19-2/h4-6H,3H2,1-2H3 |
CAS-nummer | 227958-96-5 |
Molecular Structure | ![]() |
Tetthet | 1.42g/cm3 |
Smeltepunkt | 133℃ |
Kokepunkt | 410.2°C at 760 mmHg |
Brytningsindeks | 1.643 |
Flammepunktet | 201.9°C |
Damptrykk | 6.12E-07mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |