Chemindex >227958-96-5
MY ▼
227958-96-5 etil 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate |
|
| Nama produk | etil 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate |
| Sinonim | etil 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate; |
| Nama Inggeris | ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate;ethyl 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate |
| MF | C13H11Cl2NO2S |
| Berat Molekul | 316.2029 |
| InChI | InChI=1/C13H11Cl2NO2S/c1-3-18-13(17)10-11(15)8-6-7(14)4-5-9(8)16-12(10)19-2/h4-6H,3H2,1-2H3 |
| CAS NO | 227958-96-5 |
| Struktur Molekul |  |
| Kepadatan | 1.42g/cm3 |
| Titik lebur | 133℃ |
| Titik didih | 410.2°C at 760 mmHg |
| Indeks bias | 1.643 |
| Titik nyala | 201.9°C |
| Tekanan wap | 6.12E-07mmHg at 25°C |
| Cinta bahaya |  Xi##Irritant:; |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 227958-96-5 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 