ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
227958-96-5 etil 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate |
|
Nama produk | etil 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate |
Sinonim | etil 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate; |
Nama Inggeris | ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate;ethyl 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate |
MF | C13H11Cl2NO2S |
Berat Molekul | 316.2029 |
InChI | InChI=1/C13H11Cl2NO2S/c1-3-18-13(17)10-11(15)8-6-7(14)4-5-9(8)16-12(10)19-2/h4-6H,3H2,1-2H3 |
CAS NO | 227958-96-5 |
Struktur Molekul | ![]() |
Kepadatan | 1.42g/cm3 |
Titik lebur | 133℃ |
Titik didih | 410.2°C at 760 mmHg |
Indeks bias | 1.643 |
Titik nyala | 201.9°C |
Tekanan wap | 6.12E-07mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |