Chemindex > 27215-38-9
DE ▼
27215-38-9 Laurinsäure, Monoester mit Glycerin |
|
| Produkt-Name | Laurinsäure, Monoester mit Glycerin |
| Synonyme | ;D Odecansäure, Monoester mit 1,2,3-Propantriol; Glyceryllaurat; AI3-03482; Aldo MLD;Aldo MLD-K-FG; Cithrol GML; Dimodan ML 90; Glycerinmonolaurat; Glycerinmonolaurat (VAN); Glycerox L 8; Glycerylmonolaurat; Grindtek ML 90; Imwitor 312; Laurinsäure-Monoglycerid; Lauricidin 802; Lauricidin 812; Lauricidin R; M 300; Monododecanoylglycerin; Monoglycerin-Laurat; Monolauroylglycerin; Monomuls 90L12; Monomuls L 90; NSC 4837; Gedicht M 300; Sunsoft 750; Sunsoft 757; Tegin L 90; UNII-Y98611C087; Laurin, mono- (8CI); Dodecansäure - Propan-1,2,3-triol (1:1); |
| Englischer Name | lauric acid, monoester with glycerol;Dodecanoic acid, monoester with 1,2,3-propanetriol;Glyceryl laurate;AI3-03482;Aldo MLD;Aldo MLD-K-FG;Cithrol GML;Dimodan ML 90;Glycerin monolaurate;Glycerol monolaurate (VAN);Glycerox L 8;Glyceryl monolaurate;Grindtek ML 90;Imwitor 312;Lauric acid monoglyceride;Lauricidin 802;Lauricidin 812;Lauricidin R;M 300;Monododecanoyl glycerol;Monoglycerol laurate;Monolauroylglycerin;Monomuls 90L12;Monomuls L 90;NSC 4837;Poem M 300;Sunsoft 750;Sunsoft 757;Tegin L 90;UNII-Y98611C087;Laurin, mono- (8CI);dodecanoic acid - propane-1,2,3-triol (1:1) |
| Molekulare Formel | C15H32O5 |
| Molecular Weight | 292.4116 |
| InChl | InChI=1/C12H24O2.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;4-1-3(6)2-5/h2-11H2,1H3,(H,13,14);3-6H,1-2H2 |
| CAS Registry Number | 27215-38-9 |
| EINECS | 248-337-4 |
| Molecular Structure |  |
| Siedepunkt | 296.1°C at 760 mmHg |
| Flammpunkt | 134.1°C |
| Dampfdruck | 0.000661mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 