ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27215-38-9 asam laurat, monoester dengan gliserol |
|
Nama produk | asam laurat, monoester dengan gliserol |
Sinonim | ;D asam odecanoic, monoester dengan 1,2,3-propanatriol; Gliseril laurat; AI3-03482; Aldo MLD;Aldo MLD-K-FG; Cithrol GML; Dimodan ML 90; Gliserin monolaurat; Gliserol monolaurat (VAN); gliserok L 8; Gliseril monolaurat; Grindtek ML 90; Imwitor 312; Asam laurat monogliserida; Lauricidin 802; Lauricidin 812; Lauricidin R; M 300; Monododecanoyl gliserol; Monogliserol laurat; monouroylgliserin; monomuls 90L12; Monomuls L 90; NSC 4837; Puisi M 300; Sunsoft 750; Sunsoft 757; Tegin L 90; UNII-Y98611C087; Laurin, mono- (8CI); asam dodecanoic - propana-1,2,3-triol (1:1); |
Nama bahasa Inggris | lauric acid, monoester with glycerol;Dodecanoic acid, monoester with 1,2,3-propanetriol;Glyceryl laurate;AI3-03482;Aldo MLD;Aldo MLD-K-FG;Cithrol GML;Dimodan ML 90;Glycerin monolaurate;Glycerol monolaurate (VAN);Glycerox L 8;Glyceryl monolaurate;Grindtek ML 90;Imwitor 312;Lauric acid monoglyceride;Lauricidin 802;Lauricidin 812;Lauricidin R;M 300;Monododecanoyl glycerol;Monoglycerol laurate;Monolauroylglycerin;Monomuls 90L12;Monomuls L 90;NSC 4837;Poem M 300;Sunsoft 750;Sunsoft 757;Tegin L 90;UNII-Y98611C087;Laurin, mono- (8CI);dodecanoic acid - propane-1,2,3-triol (1:1) |
MF | C15H32O5 |
Berat Molekul | 292.4116 |
InChI | InChI=1/C12H24O2.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;4-1-3(6)2-5/h2-11H2,1H3,(H,13,14);3-6H,1-2H2 |
CAS NO | 27215-38-9 |
EINECS | 248-337-4 |
Struktur Molekul | ![]() |
Titik didih | 296.1°C at 760 mmHg |
Titik nyala | 134.1°C |
Tekanan uap | 0.000661mmHg at 25°C |
MSDS |