Chemindex > 27215-38-9
NO ▼
27215-38-9 laurinsyre, monoester med glyserol |
|
| produktnavn | laurinsyre, monoester med glyserol |
| Synonymer | ;D odecanosyre, monoester med 1,2,3-propantriol; Glyserollaurat; AI3-03482; Aldo MLD;Aldo MLD-K-FG; Cithrol GML; Dimodan ML 90; Glyserin monolaurat; Glyserolmonolaurat (VAN); Glycerox L 8; Glyserolmonolaurat; Grindtek ML 90; Imwitor 312; Laurinsyre monoglyserid; Lauricidin 802; Lauricidin 812; Lauricidin R; M 300; Monododecanoyl glyserol; Monoglyserollaurat; Monolauroylglyserin; Monomuls 90L12; Monomuls L 90; NSC 4837; Dikt M 300; Sunsoft 750; Sunsoft 757; Tegin L 90; UNII-Y98611C087; Laurin, mono- (8CI); dodekansyre - propan-1,2,3-triol (1: 1); |
| Engelsk navn | lauric acid, monoester with glycerol;Dodecanoic acid, monoester with 1,2,3-propanetriol;Glyceryl laurate;AI3-03482;Aldo MLD;Aldo MLD-K-FG;Cithrol GML;Dimodan ML 90;Glycerin monolaurate;Glycerol monolaurate (VAN);Glycerox L 8;Glyceryl monolaurate;Grindtek ML 90;Imwitor 312;Lauric acid monoglyceride;Lauricidin 802;Lauricidin 812;Lauricidin R;M 300;Monododecanoyl glycerol;Monoglycerol laurate;Monolauroylglycerin;Monomuls 90L12;Monomuls L 90;NSC 4837;Poem M 300;Sunsoft 750;Sunsoft 757;Tegin L 90;UNII-Y98611C087;Laurin, mono- (8CI);dodecanoic acid - propane-1,2,3-triol (1:1) |
| Molekylær Formel | C15H32O5 |
| Molekylvekt | 292.4116 |
| InChI | InChI=1/C12H24O2.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;4-1-3(6)2-5/h2-11H2,1H3,(H,13,14);3-6H,1-2H2 |
| CAS-nummer | 27215-38-9 |
| EINECS | 248-337-4 |
| Molecular Structure |  |
| Kokepunkt | 296.1°C at 760 mmHg |
| Flammepunktet | 134.1°C |
| Damptrykk | 0.000661mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 