ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29008-35-3 Hydroxybutylmethacrylat, Gemisch aus Isomen | 
    |
| Produkt-Name | Hydroxybutylmethacrylat, Gemisch aus Isomen | 
| Synonyme | Hydroxybutylmethacrylat, Isomerengemisch; 1-(Hydroxymethyl)propyl-2-methylprop-2-enoat-2-hydroxybutyl-2-methylprop-2-enoat (1:1); | 
| Englischer Name | hydroxybutyl methacrylate, mixture of isome;Hydroxybutyl methacrylate,mixture of isomers;1-(hydroxymethyl)propyl 2-methylprop-2-enoate - 2-hydroxybutyl 2-methylprop-2-enoate (1:1) | 
| Molekulare Formel | C16H28O6 | 
| Molecular Weight | 316.3899 | 
| InChl | InChI=1/2C8H14O3/c1-4-7(9)5-11-8(10)6(2)3;1-4-7(5-9)11-8(10)6(2)3/h2*7,9H,2,4-5H2,1,3H3 | 
| CAS Registry Number | 29008-35-3 | 
| Molecular Structure | ![]()  | 
    
| Siedepunkt | 443°C at 760 mmHg | 
| Flammpunkt | 150.3°C | 
| Dampfdruck | 1.04E-09mmHg at 25°C | 
| MSDS | |