ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29008-35-3 히드록시부틸 메타크릴레이트, 이소메의 혼합물 |
|
상품명칭 | 히드록시부틸 메타크릴레이트, 이소메의 혼합물 |
별명 | ; 하이드록시부틸 메타크릴레이트, 이성질체의 혼합물; 1-(하이드록시메틸)프로필 2-메틸프롭-2-에노에이트 - 2-하이드록시부틸 2-메틸프롭-2-에노에이트(1:1); |
영문 이름 | hydroxybutyl methacrylate, mixture of isome;Hydroxybutyl methacrylate,mixture of isomers;1-(hydroxymethyl)propyl 2-methylprop-2-enoate - 2-hydroxybutyl 2-methylprop-2-enoate (1:1) |
분자식 | C16H28O6 |
분자량 | 316.3899 |
InChI | InChI=1/2C8H14O3/c1-4-7(9)5-11-8(10)6(2)3;1-4-7(5-9)11-8(10)6(2)3/h2*7,9H,2,4-5H2,1,3H3 |
cas번호 | 29008-35-3 |
분자 구조 | ![]() |
비등점 | 443°C at 760 mmHg |
인화점 | 150.3°C |
증기압 | 1.04E-09mmHg at 25°C |
MSDS |