ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29008-35-3 hydroxybutyl methacrylate, campuran isome | 
    |
| Nama produk | hydroxybutyl methacrylate, campuran isome | 
| Sinonim | ; Hydroxybutyl methacrylate, campuran isomer; 1-(hydroxymethyl)propyl 2-methylprop-2-enoate - 2-hydroxybutyl 2-methylprop-2-enoate (1:1); | 
| Nama Inggeris | hydroxybutyl methacrylate, mixture of isome;Hydroxybutyl methacrylate,mixture of isomers;1-(hydroxymethyl)propyl 2-methylprop-2-enoate - 2-hydroxybutyl 2-methylprop-2-enoate (1:1) | 
| MF | C16H28O6 | 
| Berat Molekul | 316.3899 | 
| InChI | InChI=1/2C8H14O3/c1-4-7(9)5-11-8(10)6(2)3;1-4-7(5-9)11-8(10)6(2)3/h2*7,9H,2,4-5H2,1,3H3 | 
| CAS NO | 29008-35-3 | 
| Struktur Molekul | ![]()  | 
    
| Titik didih | 443°C at 760 mmHg | 
| Titik nyala | 150.3°C | 
| Tekanan wap | 1.04E-09mmHg at 25°C | 
| MSDS | |