ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29008-35-3 hydroxybutyl methacrylate, campuran isome |
|
Nama produk | hydroxybutyl methacrylate, campuran isome |
Sinonim | ; Hydroxybutyl methacrylate, campuran isomer; 1-(hydroxymethyl)propyl 2-methylprop-2-enoate - 2-hydroxybutyl 2-methylprop-2-enoate (1:1); |
Nama Inggeris | hydroxybutyl methacrylate, mixture of isome;Hydroxybutyl methacrylate,mixture of isomers;1-(hydroxymethyl)propyl 2-methylprop-2-enoate - 2-hydroxybutyl 2-methylprop-2-enoate (1:1) |
MF | C16H28O6 |
Berat Molekul | 316.3899 |
InChI | InChI=1/2C8H14O3/c1-4-7(9)5-11-8(10)6(2)3;1-4-7(5-9)11-8(10)6(2)3/h2*7,9H,2,4-5H2,1,3H3 |
CAS NO | 29008-35-3 |
Struktur Molekul | ![]() |
Titik didih | 443°C at 760 mmHg |
Titik nyala | 150.3°C |
Tekanan wap | 1.04E-09mmHg at 25°C |
MSDS |