ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-55-7 2-(trifluoromethylthio)aniline |
|
| Produkt-Name | 2-(trifluoromethylthio)aniline |
| Englischer Name | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
| Molekulare Formel | C11H11FO4 |
| Molecular Weight | 226.201 |
| InChl | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
| CAS Registry Number | 347-55-7 |
| EINECS | 206-473-1 |
| Molecular Structure | ![]() |
| Dichte | 1.279g/cm3 |
| Siedepunkt | 422.6°C at 760 mmHg |
| Brechungsindex | 1.52 |
| Flammpunkt | 209.4°C |
| Dampfdruck | 6.78E-08mmHg at 25°C |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Beschreibung | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |