ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-55-7 2-(trifluoromethylthio)aniline | 
    |
| termék neve | 2-(trifluoromethylthio)aniline | 
| Angol név | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid | 
| MF | C11H11FO4 | 
| Molekulatömeg | 226.201 | 
| InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) | 
| CAS-szám | 347-55-7 | 
| EINECS | 206-473-1 | 
| Molekuláris szerkezete | ![]()  | 
    
| Sűrűség | 1.279g/cm3 | 
| Forráspont | 422.6°C at 760 mmHg | 
| Törésmutató | 1.52 | 
| Gyulladáspont | 209.4°C | 
| Gőznyomás | 6.78E-08mmHg at 25°C | 
| Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
    
| Biztonsági Leírás | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; | 
    
| MSDS | |