ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-55-7 2-(trifluoromethylthio)aniline |
|
produktnavn | 2-(trifluoromethylthio)aniline |
Engelsk navn | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
Molekylær Formel | C11H11FO4 |
Molekylvekt | 226.201 |
InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
CAS-nummer | 347-55-7 |
EINECS | 206-473-1 |
Molecular Structure | ![]() |
Tetthet | 1.279g/cm3 |
Kokepunkt | 422.6°C at 760 mmHg |
Brytningsindeks | 1.52 |
Flammepunktet | 209.4°C |
Damptrykk | 6.78E-08mmHg at 25°C |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |