ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
452-68-6 2-Fluoro-5-Iodotoluene |
|
| Produkt-Name | 2-Fluoro-5-Iodotoluene |
| Englischer Name | 2-Fluoro-5-Iodotoluene; |
| Molekulare Formel | C7H6FI |
| Molecular Weight | 236.02 |
| InChl | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| CAS Registry Number | 452-68-6 |
| EINECS | 207-206-1 |
| Molecular Structure | ![]() |
| Risk Codes | R36/38##Irritating to eyes and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |