ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
452-68-6 2-Fluoro-5-Iodotoluene |
|
| termék neve | 2-Fluoro-5-Iodotoluene |
| Angol név | 2-Fluoro-5-Iodotoluene; |
| MF | C7H6FI |
| Molekulatömeg | 236.02 |
| InChI | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| CAS-szám | 452-68-6 |
| EINECS | 207-206-1 |
| Molekuláris szerkezete | ![]() |
| Kockázatot kódok | R36/38##Irritating to eyes and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |