ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
452-68-6 2-Fluoro-5-Iodotoluene |
|
| Nome del prodotto | 2-Fluoro-5-Iodotoluene |
| Nome inglese | 2-Fluoro-5-Iodotoluene; |
| Formula molecolare | C7H6FI |
| Peso Molecolare | 236.02 |
| InChI | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| Numero CAS | 452-68-6 |
| EINECS | 207-206-1 |
| Struttura molecolare | ![]() |
| Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |