ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
491-78-1 Primuletin |
|
Produkt-Name | Primuletin |
Englischer Name | Primuletin;5-Hydroxyflavone;5-Hydroxy-2-phenylchromone;5-hydroxy-2-phenyl-4H-chromen-4-one |
Molekulare Formel | C15H10O3 |
Molecular Weight | 238.2381 |
InChl | InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
CAS Registry Number | 491-78-1 |
EINECS | 207-743-1 |
Molecular Structure | ![]() |
Dichte | 1.34g/cm3 |
Siedepunkt | 425°C at 760 mmHg |
Brechungsindex | 1.666 |
Flammpunkt | 165.4°C |
Dampfdruck | 7.97E-08mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |