ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
491-78-1 Primuletin |
|
상품명칭 | Primuletin |
영문 이름 | Primuletin;5-Hydroxyflavone;5-Hydroxy-2-phenylchromone;5-hydroxy-2-phenyl-4H-chromen-4-one |
분자식 | C15H10O3 |
분자량 | 238.2381 |
InChI | InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
cas번호 | 491-78-1 |
EC번호 | 207-743-1 |
분자 구조 | ![]() |
밀도 | 1.34g/cm3 |
비등점 | 425°C at 760 mmHg |
굴절 지수 | 1.666 |
인화점 | 165.4°C |
증기압 | 7.97E-08mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |