ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
491-78-1 Primuletin |
|
Nama produk | Primuletin |
Nama bahasa Inggris | Primuletin;5-Hydroxyflavone;5-Hydroxy-2-phenylchromone;5-hydroxy-2-phenyl-4H-chromen-4-one |
MF | C15H10O3 |
Berat Molekul | 238.2381 |
InChI | InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
CAS NO | 491-78-1 |
EINECS | 207-743-1 |
Struktur Molekul | ![]() |
Kepadatan | 1.34g/cm3 |
Titik didih | 425°C at 760 mmHg |
Indeks bias | 1.666 |
Titik nyala | 165.4°C |
Tekanan uap | 7.97E-08mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |