ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
492-99-9 1,2-Cyclohexanedione dioxime |
|
| Produkt-Name | 1,2-Cyclohexanedione dioxime |
| Englischer Name | 1,2-Cyclohexanedione dioxime;Nioxime?Nioxime(rg;N-hydroxy-2-nitrosocyclohex-1-en-1-amine;(1E,2E)-N,N'-dihydroxycyclohexane-1,2-diimine;(1Z,2E)-N,N'-dihydroxycyclohexane-1,2-diimine |
| Molekulare Formel | C6H10N2O2 |
| Molecular Weight | 142.1558 |
| InChl | InChI=1/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h9-10H,1-4H2/b7-5-,8-6+ |
| CAS Registry Number | 492-99-9 |
| EINECS | 207-769-3 |
| Molecular Structure | ![]() |
| Dichte | 1.361g/cm3 |
| Schmelzpunkt | 181-188℃ |
| Siedepunkt | 339.042°C at 760 mmHg |
| Brechungsindex | 1.594 |
| Flammpunkt | 210.08°C |
| Dampfdruck | 0mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |