ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
492-99-9 1,2-Cyclohexanedione dioxime |
|
상품명칭 | 1,2-Cyclohexanedione dioxime |
영문 이름 | 1,2-Cyclohexanedione dioxime;Nioxime?Nioxime(rg;N-hydroxy-2-nitrosocyclohex-1-en-1-amine;(1E,2E)-N,N'-dihydroxycyclohexane-1,2-diimine;(1Z,2E)-N,N'-dihydroxycyclohexane-1,2-diimine |
분자식 | C6H10N2O2 |
분자량 | 142.1558 |
InChI | InChI=1/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h9-10H,1-4H2/b7-5-,8-6+ |
cas번호 | 492-99-9 |
EC번호 | 207-769-3 |
분자 구조 | ![]() |
밀도 | 1.361g/cm3 |
녹는 점 | 181-188℃ |
비등점 | 339.042°C at 760 mmHg |
굴절 지수 | 1.594 |
인화점 | 210.08°C |
증기압 | 0mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |