ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
492-99-9 1,2-Cyclohexanedione dioxime |
|
| Naam product | 1,2-Cyclohexanedione dioxime |
| Engelse naam | 1,2-Cyclohexanedione dioxime;Nioxime?Nioxime(rg;N-hydroxy-2-nitrosocyclohex-1-en-1-amine;(1E,2E)-N,N'-dihydroxycyclohexane-1,2-diimine;(1Z,2E)-N,N'-dihydroxycyclohexane-1,2-diimine |
| MF | C6H10N2O2 |
| Molecuulgewicht | 142.1558 |
| InChI | InChI=1/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h9-10H,1-4H2/b7-5-,8-6+ |
| CAS-nummer | 492-99-9 |
| EINECS | 207-769-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.361g/cm3 |
| Smeltpunt | 181-188℃ |
| Kookpunt | 339.042°C at 760 mmHg |
| Brekingsindex | 1.594 |
| Vlampunt | 210.08°C |
| Dampdruk | 0mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |