ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52414-91-2 4-Ethyl-5-methylthiazol |
|
| Produkt-Name | 4-Ethyl-5-methylthiazol |
| Synonyme | 4-Ethyl-5-methylthiazol; Thiazol, 4-Ethyl-5-methyl-; 4-Ethyl-5-methyl-1,3-thiazol; |
| Englischer Name | 4-ethyl-5-methylthiazole;4-Ethyl-5-methylthiazole;Thiazole, 4-ethyl-5-methyl-;4-ethyl-5-methyl-1,3-thiazole |
| Molekulare Formel | C6H9NS |
| Molecular Weight | 127.2074 |
| InChl | InChI=1/C6H9NS/c1-3-6-5(2)8-4-7-6/h4H,3H2,1-2H3 |
| CAS Registry Number | 52414-91-2 |
| EINECS | 257-904-5 |
| Molecular Structure | ![]() |
| Dichte | 1.049g/cm3 |
| Siedepunkt | 181.3°C at 760 mmHg |
| Brechungsindex | 1.524 |
| Flammpunkt | 68.1°C |
| Dampfdruck | 1.17mmHg at 25°C |
| MSDS | |